C24H29N5O3 — CID 139496437
methyl 3-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]propaneperoxoate (PubChem CID 139496437) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is methyl 3-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]propaneperoxoate.
| Compound Name | methyl 3-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]propaneperoxoate |
|---|---|
| PubChem CID | 139496437 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | methyl 3-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]propaneperoxoate |
| SMILES | COOC(=O)CCN(CCN(Cc1ccccn1)Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C24H29N5O3/c1-31-32-24(30)11-15-28(18-21-8-2-5-12-25-21)16-17-29(19-22-9-3-6-13-26-22)20-23-10-4-7-14-27-23/h2-10,12-14H,11,15-20H2,1H3 |
| InChIKey | AJXUDYJTHYWEJD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|