C20H27N3O2 — CID 67061848
8-[bis(pyridin-2-ylmethyl)amino]octanoic acid (PubChem CID 67061848) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 8-[bis(pyridin-2-ylmethyl)amino]octanoic acid.
| Compound Name | 8-[bis(pyridin-2-ylmethyl)amino]octanoic acid |
|---|---|
| PubChem CID | 67061848 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 8-[bis(pyridin-2-ylmethyl)amino]octanoic acid |
| SMILES | O=C(O)CCCCCCCN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C20H27N3O2/c24-20(25)12-4-2-1-3-9-15-23(16-18-10-5-7-13-21-18)17-19-11-6-8-14-22-19/h5-8,10-11,13-14H,1-4,9,12,15-17H2,(H,24,25) |
| InChIKey | NUBHRRRBXXCAPB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|