C20H26F3N4O2Re- — CID 160678360
N',N'-bis(pyridin-2-ylmethyl)hexane-1,6-diamine;rhenium;2,2,2-trifluoroacetate (PubChem CID 160678360) has the molecular formula C20H26F3N4O2Re- and a molecular weight of 597.66 g/mol. Its IUPAC name is N',N'-bis(pyridin-2-ylmethyl)hexane-1,6-diamine;rhenium;2,2,2-trifluoroacetate.
| Compound Name | N',N'-bis(pyridin-2-ylmethyl)hexane-1,6-diamine;rhenium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160678360 |
| Molecular Formula | C20H26F3N4O2Re- |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | N',N'-bis(pyridin-2-ylmethyl)hexane-1,6-diamine;rhenium;2,2,2-trifluoroacetate |
| SMILES | NCCCCCCN(Cc1ccccn1)Cc1ccccn1.O=C([O-])C(F)(F)F.[Re] |
| InChI | InChI=1S/C18H26N4.C2HF3O2.Re/c19-11-5-1-2-8-14-22(15-17-9-3-6-12-20-17)16-18-10-4-7-13-21-18;3-2(4,5)1(6)7;/h3-4,6-7,9-10,12-13H,1-2,5,8,11,14-16,19H2;(H,6,7);/p-1 |
| InChIKey | AXNJEIWOXIIBTD-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|