C35H45N13 — CID 102530865
2-N-(2-aminoethyl)-4-N,6-N-bis[3-[bis(pyridin-2-ylmethyl)amino]propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 102530865) has the molecular formula C35H45N13 and a molecular weight of 647.84 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-4-N,6-N-bis[3-[bis(pyridin-2-ylmethyl)amino]propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2-aminoethyl)-4-N,6-N-bis[3-[bis(pyridin-2-ylmethyl)amino]propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 102530865 |
| Molecular Formula | C35H45N13 |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.39 |
| IUPAC Name | 2-N-(2-aminoethyl)-4-N,6-N-bis[3-[bis(pyridin-2-ylmethyl)amino]propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCNc1nc(NCCCN(Cc2ccccn2)Cc2ccccn2)nc(NCCCN(Cc2ccccn2)Cc2ccccn2)n1 |
| InChI | InChI=1S/C35H45N13/c36-15-22-43-35-45-33(41-20-9-23-47(25-29-11-1-5-16-37-29)26-30-12-2-6-17-38-30)44-34(46-35)42-21-10-24-48(27-31-13-3-7-18-39-31)28-32-14-4-8-19-40-32/h1-8,11-14,16-19H,9-10,15,20-28,36H2,(H3,41,42,43,44,45,46) |
| InChIKey | HDZGQGNLPCKBOT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|