C44H44N8O2 — CID 132594516
1,8-bis[3-[bis(pyridin-2-ylmethyl)amino]propylamino]anthracene-9,10-dione (PubChem CID 132594516) has the molecular formula C44H44N8O2 and a molecular weight of 716.89 g/mol. Its IUPAC name is 1,8-bis[3-[bis(pyridin-2-ylmethyl)amino]propylamino]anthracene-9,10-dione.
| Compound Name | 1,8-bis[3-[bis(pyridin-2-ylmethyl)amino]propylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 132594516 |
| Molecular Formula | C44H44N8O2 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 1,8-bis[3-[bis(pyridin-2-ylmethyl)amino]propylamino]anthracene-9,10-dione |
| SMILES | O=C1c2cccc(NCCCN(Cc3ccccn3)Cc3ccccn3)c2C(=O)c2c(NCCCN(Cc3ccccn3)Cc3ccccn3)cccc21 |
| InChI | InChI=1S/C44H44N8O2/c53-43-37-17-9-19-39(49-25-11-27-51(29-33-13-1-5-21-45-33)30-34-14-2-6-22-46-34)41(37)44(54)42-38(43)18-10-20-40(42)50-26-12-28-52(31-35-15-3-7-23-47-35)32-36-16-4-8-24-48-36/h1-10,13-24,49-50H,11-12,25-32H2 |
| InChIKey | NBHCUGBSCFXXCH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|