C30H30N6O2 — CID 154728853
2-[2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]ethyl]isoindole-1,3-dione (PubChem CID 154728853) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154728853 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[2-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN(CCN(Cc1ccccn1)Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C30H30N6O2/c37-29-27-12-1-2-13-28(27)30(38)36(29)20-19-34(21-24-9-3-6-14-31-24)17-18-35(22-25-10-4-7-15-32-25)23-26-11-5-8-16-33-26/h1-16H,17-23H2 |
| InChIKey | SMVDVICZEOOLOI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|