C25H35N4O2+ — CID 135183143
3-[[5-[3-(dimethylamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl-trimethylazanium (PubChem CID 135183143) has the molecular formula C25H35N4O2+ and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-[[5-[3-(dimethylamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[5-[3-(dimethylamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 135183143 |
| Molecular Formula | C25H35N4O2+ |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 3-[[5-[3-(dimethylamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl-trimethylazanium |
| SMILES | CN(C)CCCNc1cccc2c1C(=O)c1cccc(NCCC[N+](C)(C)C)c1C2=O |
| InChI | InChI=1S/C25H34N4O2/c1-28(2)16-8-14-26-20-12-6-10-18-22(20)24(30)19-11-7-13-21(23(19)25(18)31)27-15-9-17-29(3,4)5/h6-7,10-13H,8-9,14-17H2,1-5H3,(H-,26,27,30,31)/p+1 |
| InChIKey | UOAWGEYOWFECJJ-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|