C20H22N2O2 — CID 175308247
1-[3-(dimethylamino)propylamino]-6-methylanthracene-9,10-dione (PubChem CID 175308247) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propylamino]-6-methylanthracene-9,10-dione.
| Compound Name | 1-[3-(dimethylamino)propylamino]-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 175308247 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[3-(dimethylamino)propylamino]-6-methylanthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1)C(=O)c1cccc(NCCCN(C)C)c1C2=O |
| InChI | InChI=1S/C20H22N2O2/c1-13-8-9-14-16(12-13)19(23)15-6-4-7-17(18(15)20(14)24)21-10-5-11-22(2)3/h4,6-9,12,21H,5,10-11H2,1-3H3 |
| InChIKey | LTVUSBJSAIMVIQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|