C16H20N4O2 — CID 170716889
2-amino-4-[bis(pyridin-2-ylmethyl)amino]butanoic acid (PubChem CID 170716889) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-amino-4-[bis(pyridin-2-ylmethyl)amino]butanoic acid.
| Compound Name | 2-amino-4-[bis(pyridin-2-ylmethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 170716889 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-amino-4-[bis(pyridin-2-ylmethyl)amino]butanoic acid |
| SMILES | NC(CCN(Cc1ccccn1)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C16H20N4O2/c17-15(16(21)22)7-10-20(11-13-5-1-3-8-18-13)12-14-6-2-4-9-19-14/h1-6,8-9,15H,7,10-12,17H2,(H,21,22) |
| InChIKey | XGOLEJWPPDQICZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |