C28H28N4O4 — CID 155922197
(2R)-2-amino-4-[bis[(2-pyridin-2-yloxyphenyl)methyl]amino]butanoic acid (PubChem CID 155922197) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is (2R)-2-amino-4-[bis[(2-pyridin-2-yloxyphenyl)methyl]amino]butanoic acid.
| Compound Name | (2R)-2-amino-4-[bis[(2-pyridin-2-yloxyphenyl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155922197 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (2R)-2-amino-4-[bis[(2-pyridin-2-yloxyphenyl)methyl]amino]butanoic acid |
| SMILES | N[C@H](CCN(Cc1ccccc1Oc1ccccn1)Cc1ccccc1Oc1ccccn1)C(=O)O |
| InChI | InChI=1S/C28H28N4O4/c29-23(28(33)34)15-18-32(19-21-9-1-3-11-24(21)35-26-13-5-7-16-30-26)20-22-10-2-4-12-25(22)36-27-14-6-8-17-31-27/h1-14,16-17,23H,15,18-20,29H2,(H,33,34)/t23-/m1/s1 |
| InChIKey | OGKRGHHJBKQKQZ-HSZRJFAPSA-N |
| XLogP | 4.87 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |