C13H21N3O5S — CID 70945897
2-amino-4-[(2-methoxyphenyl)methyl-(methylsulfamoyl)amino]butanoic acid (PubChem CID 70945897) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-amino-4-[(2-methoxyphenyl)methyl-(methylsulfamoyl)amino]butanoic acid.
| Compound Name | 2-amino-4-[(2-methoxyphenyl)methyl-(methylsulfamoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 70945897 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-amino-4-[(2-methoxyphenyl)methyl-(methylsulfamoyl)amino]butanoic acid |
| SMILES | CNS(=O)(=O)N(CCC(N)C(=O)O)Cc1ccccc1OC |
| InChI | InChI=1S/C13H21N3O5S/c1-15-22(19,20)16(8-7-11(14)13(17)18)9-10-5-3-4-6-12(10)21-2/h3-6,11,15H,7-9,14H2,1-2H3,(H,17,18) |
| InChIKey | IYNLBLJYSVWIJI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |