C30H28Cl2N2O4 — CID 127035812
(2S)-2-amino-4-[bis[[2-(4-chlorophenoxy)phenyl]methyl]amino]butanoic acid (PubChem CID 127035812) has the molecular formula C30H28Cl2N2O4 and a molecular weight of 551.47 g/mol. Its IUPAC name is (2S)-2-amino-4-[bis[[2-(4-chlorophenoxy)phenyl]methyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[bis[[2-(4-chlorophenoxy)phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 127035812 |
| Molecular Formula | C30H28Cl2N2O4 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | (2S)-2-amino-4-[bis[[2-(4-chlorophenoxy)phenyl]methyl]amino]butanoic acid |
| SMILES | N[C@@H](CCN(Cc1ccccc1Oc1ccc(Cl)cc1)Cc1ccccc1Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C30H28Cl2N2O4/c31-23-9-13-25(14-10-23)37-28-7-3-1-5-21(28)19-34(18-17-27(33)30(35)36)20-22-6-2-4-8-29(22)38-26-15-11-24(32)12-16-26/h1-16,27H,17-20,33H2,(H,35,36)/t27-/m0/s1 |
| InChIKey | UOCICUPZUHGXCB-MHZLTWQESA-N |
| XLogP | 7.38 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |