C30H32N4O4 — CID 155922207
(2R)-2-amino-4-[bis[[2-(pyridin-3-ylmethoxy)phenyl]methyl]amino]butanoic acid (PubChem CID 155922207) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is (2R)-2-amino-4-[bis[[2-(pyridin-3-ylmethoxy)phenyl]methyl]amino]butanoic acid.
| Compound Name | (2R)-2-amino-4-[bis[[2-(pyridin-3-ylmethoxy)phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155922207 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (2R)-2-amino-4-[bis[[2-(pyridin-3-ylmethoxy)phenyl]methyl]amino]butanoic acid |
| SMILES | N[C@H](CCN(Cc1ccccc1OCc1cccnc1)Cc1ccccc1OCc1cccnc1)C(=O)O |
| InChI | InChI=1S/C30H32N4O4/c31-27(30(35)36)13-16-34(19-25-9-1-3-11-28(25)37-21-23-7-5-14-32-17-23)20-26-10-2-4-12-29(26)38-22-24-8-6-15-33-18-24/h1-12,14-15,17-18,27H,13,16,19-22,31H2,(H,35,36)/t27-/m1/s1 |
| InChIKey | OZMUUBSCOVQQOF-HHHXNRCGSA-N |
| XLogP | 4.44 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |