C32H32F2N2O4 — CID 127036014
(2S)-2-amino-4-[bis[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]amino]butanoic acid (PubChem CID 127036014) has the molecular formula C32H32F2N2O4 and a molecular weight of 546.61 g/mol. Its IUPAC name is (2S)-2-amino-4-[bis[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[bis[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 127036014 |
| Molecular Formula | C32H32F2N2O4 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | (2S)-2-amino-4-[bis[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]amino]butanoic acid |
| SMILES | N[C@@H](CCN(Cc1ccccc1OCc1ccc(F)cc1)Cc1ccccc1OCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C32H32F2N2O4/c33-27-13-9-23(10-14-27)21-39-30-7-3-1-5-25(30)19-36(18-17-29(35)32(37)38)20-26-6-2-4-8-31(26)40-22-24-11-15-28(34)16-12-24/h1-16,29H,17-22,35H2,(H,37,38)/t29-/m0/s1 |
| InChIKey | IWIYOBMPFZAQBZ-LJAQVGFWSA-N |
| XLogP | 5.93 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |