C8H11ClN2O2 — CID 46705394
(2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride (PubChem CID 46705394) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is (2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 46705394 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C8H10N2O2.ClH/c9-7(8(11)12)5-6-3-1-2-4-10-6;/h1-4,7H,5,9H2,(H,11,12);1H/t7-;/m0./s1 |
| InChIKey | ZOSGLKLQNRBVPD-FJXQXJEOSA-N |
| XLogP | 0.46 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |