C7H10ClN3O2 — CID 178184520
(2S)-2-amino-3-pyrazin-2-ylpropanoic acid;hydrochloride (PubChem CID 178184520) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is (2S)-2-amino-3-pyrazin-2-ylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-pyrazin-2-ylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 178184520 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (2S)-2-amino-3-pyrazin-2-ylpropanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1cnccn1)C(=O)O |
| InChI | InChI=1S/C7H9N3O2.ClH/c8-6(7(11)12)3-5-4-9-1-2-10-5;/h1-2,4,6H,3,8H2,(H,11,12);1H/t6-;/m0./s1 |
| InChIKey | GRPAZAIKYSYICX-RGMNGODLSA-N |
| XLogP | -0.15 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |