2-amino-3-(1,2,4-triazin-6-yl)propanoic acid

C6H8N4O2 — CID 83827024

IUPAC2-amino-3-(1,2,4-triazin-6-yl)propanoic acid
SMILESNC(Cc1cncnn1)C(=O)O
InChIInChI=1S/C6H8N4O2/c7-5(6(11)12)1-4-2-8-3-9-10-4/h2-3,5H,1,7H2,(H,11,12)
InChIKeyQLEWCRKSIKZVCG-UHFFFAOYSA-N
MW168.16 g/mol
LogP-1.17
Rot. Bonds3

About 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid

2-amino-3-(1,2,4-triazin-6-yl)propanoic acid (PubChem CID 83827024) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(1,2,4-triazin-6-yl)propanoic acid
PubChem CID83827024
Molecular FormulaC6H8N4O2
Molecular Weight168.16 g/mol
Exact Mass168.06
IUPAC Name2-amino-3-(1,2,4-triazin-6-yl)propanoic acid
SMILESNC(Cc1cncnn1)C(=O)O
InChIInChI=1S/C6H8N4O2/c7-5(6(11)12)1-4-2-8-3-9-10-4/h2-3,5H,1,7H2,(H,11,12)
InChIKeyQLEWCRKSIKZVCG-UHFFFAOYSA-N
XLogP-1.17
TPSA101.99 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.16
LogP ≤ 5-1.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid (CID 83827024) is 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid is NC(Cc1cncnn1)C(=O)O.
What is the InChIKey of 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid?
The InChIKey is QLEWCRKSIKZVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c7-5(6(11)12)1-4-2-8-3-9-10-4/h2-3,5H,1,7H2,(H,11,12).
What are the key properties of 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid?
2-amino-3-(1,2,4-triazin-6-yl)propanoic acid has a molecular weight of 168.16 g/mol, XLogP of -1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,2,4-triazin-6-yl)propanoic acid is sourced from PubChem (CID 83827024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).