C5H7N3O3 — CID 69085680
(2S)-2-amino-3-(oxadiazol-5-yl)propanoic acid (PubChem CID 69085680) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is (2S)-2-amino-3-(oxadiazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(oxadiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 69085680 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (2S)-2-amino-3-(oxadiazol-5-yl)propanoic acid |
| SMILES | N[C@@H](Cc1cnno1)C(=O)O |
| InChI | InChI=1S/C5H7N3O3/c6-4(5(9)10)1-3-2-7-8-11-3/h2,4H,1,6H2,(H,9,10)/t4-/m0/s1 |
| InChIKey | YCCNCPQGKLWRMA-BYPYZUCNSA-N |
| XLogP | -0.98 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |