(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid

C6H8N2O3 — CID 93495290

IUPAC(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid
SMILESN[C@H](Cc1ccno1)C(=O)O
InChIInChI=1S/C6H8N2O3/c7-5(6(9)10)3-4-1-2-8-11-4/h1-2,5H,3,7H2,(H,9,10)/t5-/m1/s1
InChIKeyYZRGWMSKFDDWIE-RXMQYKEDSA-N
MW156.14 g/mol
LogP-0.37
Rot. Bonds3

About (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid

(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid (PubChem CID 93495290) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid
PubChem CID93495290
Molecular FormulaC6H8N2O3
Molecular Weight156.14 g/mol
Exact Mass156.05
IUPAC Name(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid
SMILESN[C@H](Cc1ccno1)C(=O)O
InChIInChI=1S/C6H8N2O3/c7-5(6(9)10)3-4-1-2-8-11-4/h1-2,5H,3,7H2,(H,9,10)/t5-/m1/s1
InChIKeyYZRGWMSKFDDWIE-RXMQYKEDSA-N
XLogP-0.37
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 5-0.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid (CID 93495290) is (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid is N[C@H](Cc1ccno1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid?
The InChIKey is YZRGWMSKFDDWIE-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H8N2O3/c7-5(6(9)10)3-4-1-2-8-11-4/h1-2,5H,3,7H2,(H,9,10)/t5-/m1/s1.
What are the key properties of (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid?
(2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid has a molecular weight of 156.14 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(1,2-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 93495290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).