C8H9FN2O2 — CID 55267324
2-amino-3-(3-fluoro-4-pyridinyl)propanoic acid (PubChem CID 55267324) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is 2-amino-3-(3-fluoro-4-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(3-fluoro-4-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 55267324 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-amino-3-(3-fluoro-4-pyridinyl)propanoic acid |
| SMILES | NC(Cc1ccncc1F)C(=O)O |
| InChI | InChI=1S/C8H9FN2O2/c9-6-4-11-2-1-5(6)3-7(10)8(12)13/h1-2,4,7H,3,10H2,(H,12,13) |
| InChIKey | QSXTUHPQQNCJMM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |