C9H11BFNO4 — CID 10092781
2-amino-3-(4-borono-2-fluorophenyl)propanoic acid (PubChem CID 10092781) has the molecular formula C9H11BFNO4 and a molecular weight of 227.00 g/mol. Its IUPAC name is 2-amino-3-(4-borono-2-fluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-borono-2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 10092781 |
| Molecular Formula | C9H11BFNO4 |
| Molecular Weight | 227.00 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-amino-3-(4-borono-2-fluorophenyl)propanoic acid |
| SMILES | NC(Cc1ccc(B(O)O)cc1F)C(=O)O |
| InChI | InChI=1S/C9H11BFNO4/c11-7-4-6(10(15)16)2-1-5(7)3-8(12)9(13)14/h1-2,4,8,15-16H,3,12H2,(H,13,14) |
| InChIKey | GGGVVBGRTWMSPX-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.00 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|