C9H12FNO5 — CID 66764594
(2S)-2-amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid;hydrate (PubChem CID 66764594) has the molecular formula C9H12FNO5 and a molecular weight of 233.19 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid;hydrate.
| Compound Name | (2S)-2-amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 66764594 |
| Molecular Formula | C9H12FNO5 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2S)-2-amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid;hydrate |
| SMILES | N[C@@H](Cc1cc(O)c(O)cc1F)C(=O)O.O |
| InChI | InChI=1S/C9H10FNO4.H2O/c10-5-3-8(13)7(12)2-4(5)1-6(11)9(14)15;/h2-3,6,12-13H,1,11H2,(H,14,15);1H2/t6-;/m0./s1 |
| InChIKey | KSCOLSICORQZPI-RGMNGODLSA-N |
| XLogP | -0.63 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|