C9H10FNO3 — CID 14211589
2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid (PubChem CID 14211589) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 14211589 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid |
| SMILES | NC(Cc1cc(O)ccc1F)C(=O)O |
| InChI | InChI=1S/C9H10FNO3/c10-7-2-1-6(12)3-5(7)4-8(11)9(13)14/h1-3,8,12H,4,11H2,(H,13,14) |
| InChIKey | YTYMWTLCTJSNDC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |