C9H12NO6P — CID 57008274
(2S)-2-amino-3-(4-hydroxy-2-phosphonophenyl)propanoic acid (PubChem CID 57008274) has the molecular formula C9H12NO6P and a molecular weight of 261.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxy-2-phosphonophenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-hydroxy-2-phosphonophenyl)propanoic acid |
|---|---|
| PubChem CID | 57008274 |
| Molecular Formula | C9H12NO6P |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-2-phosphonophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C9H12NO6P/c10-7(9(12)13)3-5-1-2-6(11)4-8(5)17(14,15)16/h1-2,4,7,11H,3,10H2,(H,12,13)(H2,14,15,16)/t7-/m0/s1 |
| InChIKey | MUYJKCHJGVIUAR-ZETCQYMHSA-N |
| XLogP | -0.85 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|