C12H17NO9S2 — CID 56993310
(2S)-2-amino-3-[2-(1,3-disulfopropan-2-yl)-4-hydroxyphenyl]propanoic acid (PubChem CID 56993310) has the molecular formula C12H17NO9S2 and a molecular weight of 383.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(1,3-disulfopropan-2-yl)-4-hydroxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(1,3-disulfopropan-2-yl)-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 56993310 |
| Molecular Formula | C12H17NO9S2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (2S)-2-amino-3-[2-(1,3-disulfopropan-2-yl)-4-hydroxyphenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1C(CS(=O)(=O)O)CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C12H17NO9S2/c13-11(12(15)16)3-7-1-2-9(14)4-10(7)8(5-23(17,18)19)6-24(20,21)22/h1-2,4,8,11,14H,3,5-6,13H2,(H,15,16)(H,17,18,19)(H,20,21,22)/t11-/m0/s1 |
| InChIKey | SYKROQGZDQGVLS-NSHDSACASA-N |
| XLogP | -0.79 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|