C10H11F2NO2S — CID 117370022
2-amino-3-(2,5-difluoro-4-methylsulfanylphenyl)propanoic acid (PubChem CID 117370022) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-amino-3-(2,5-difluoro-4-methylsulfanylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(2,5-difluoro-4-methylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117370022 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-amino-3-(2,5-difluoro-4-methylsulfanylphenyl)propanoic acid |
| SMILES | CSc1cc(F)c(CC(N)C(=O)O)cc1F |
| InChI | InChI=1S/C10H11F2NO2S/c1-16-9-4-6(11)5(2-7(9)12)3-8(13)10(14)15/h2,4,8H,3,13H2,1H3,(H,14,15) |
| InChIKey | ROIVPOVKLUCBFI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |