C11H14FNO2 — CID 84781647
2-amino-3-(5-fluoro-2,4-dimethylphenyl)propanoic acid (PubChem CID 84781647) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-amino-3-(5-fluoro-2,4-dimethylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(5-fluoro-2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 84781647 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-amino-3-(5-fluoro-2,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)c(CC(N)C(=O)O)cc1F |
| InChI | InChI=1S/C11H14FNO2/c1-6-3-7(2)9(12)4-8(6)5-10(13)11(14)15/h3-4,10H,5,13H2,1-2H3,(H,14,15) |
| InChIKey | ZUQGAXDGNQVAIL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |