C10H10ClF2NO3 — CID 117418267
2-amino-3-(4-chloro-3,5-difluoro-2-methoxyphenyl)propanoic acid (PubChem CID 117418267) has the molecular formula C10H10ClF2NO3 and a molecular weight of 265.64 g/mol. Its IUPAC name is 2-amino-3-(4-chloro-3,5-difluoro-2-methoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-chloro-3,5-difluoro-2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117418267 |
| Molecular Formula | C10H10ClF2NO3 |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-amino-3-(4-chloro-3,5-difluoro-2-methoxyphenyl)propanoic acid |
| SMILES | COc1c(CC(N)C(=O)O)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C10H10ClF2NO3/c1-17-9-4(3-6(14)10(15)16)2-5(12)7(11)8(9)13/h2,6H,3,14H2,1H3,(H,15,16) |
| InChIKey | ASVJBFFOGRPWLB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|