C9H7ClF2O4 — CID 117384544
2-(4-chloro-3,5-difluoro-2-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117384544) has the molecular formula C9H7ClF2O4 and a molecular weight of 252.60 g/mol. Its IUPAC name is 2-(4-chloro-3,5-difluoro-2-methoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(4-chloro-3,5-difluoro-2-methoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117384544 |
| Molecular Formula | C9H7ClF2O4 |
| Molecular Weight | 252.60 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-(4-chloro-3,5-difluoro-2-methoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1c(C(O)C(=O)O)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H7ClF2O4/c1-16-8-3(7(13)9(14)15)2-4(11)5(10)6(8)12/h2,7,13H,1H3,(H,14,15) |
| InChIKey | QGBKJWIWWCEACK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|