C9H8F2O4 — CID 117310492
2-(2,4-difluoro-5-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117310492) has the molecular formula C9H8F2O4 and a molecular weight of 218.16 g/mol. Its IUPAC name is 2-(2,4-difluoro-5-methoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,4-difluoro-5-methoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117310492 |
| Molecular Formula | C9H8F2O4 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2-(2,4-difluoro-5-methoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(C(O)C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C9H8F2O4/c1-15-7-2-4(8(12)9(13)14)5(10)3-6(7)11/h2-3,8,12H,1H3,(H,13,14) |
| InChIKey | ACCRCIZGFIRYBF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |