C10H12FNO5 — CID 170824441
3-(4-amino-2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170824441) has the molecular formula C10H12FNO5 and a molecular weight of 245.21 g/mol. Its IUPAC name is 3-(4-amino-2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-amino-2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824441 |
| Molecular Formula | C10H12FNO5 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(4-amino-2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropanoic acid |
| SMILES | COc1cc(C(O)C(O)C(=O)O)c(F)cc1N |
| InChI | InChI=1S/C10H12FNO5/c1-17-7-2-4(5(11)3-6(7)12)8(13)9(14)10(15)16/h2-3,8-9,13-14H,12H2,1H3,(H,15,16) |
| InChIKey | BABSGOPLIMHLCY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|