C11H17FN2O3 — CID 171881741
4-amino-1-(4-amino-2-fluoro-5-methoxyphenyl)butane-1,2-diol (PubChem CID 171881741) has the molecular formula C11H17FN2O3 and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-amino-1-(4-amino-2-fluoro-5-methoxyphenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(4-amino-2-fluoro-5-methoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881741 |
| Molecular Formula | C11H17FN2O3 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-amino-1-(4-amino-2-fluoro-5-methoxyphenyl)butane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCN)c(F)cc1N |
| InChI | InChI=1S/C11H17FN2O3/c1-17-10-4-6(7(12)5-8(10)14)11(16)9(15)2-3-13/h4-5,9,11,15-16H,2-3,13-14H2,1H3 |
| InChIKey | NQFMHCFYVDVAQH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|