C11H13F2NO3 — CID 171881608
4-(4-amino-1,2-dihydroxybutyl)-2,5-difluorobenzaldehyde (PubChem CID 171881608) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxybutyl)-2,5-difluorobenzaldehyde.
| Compound Name | 4-(4-amino-1,2-dihydroxybutyl)-2,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 171881608 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxybutyl)-2,5-difluorobenzaldehyde |
| SMILES | NCCC(O)C(O)c1cc(F)c(C=O)cc1F |
| InChI | InChI=1S/C11H13F2NO3/c12-8-4-7(9(13)3-6(8)5-15)11(17)10(16)1-2-14/h3-5,10-11,16-17H,1-2,14H2 |
| InChIKey | LRZXJQUFPSYSPG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|