C10H12FNO3 — CID 170827927
2-(3-amino-1,2-dihydroxypropyl)-4-fluorobenzaldehyde (PubChem CID 170827927) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-(3-amino-1,2-dihydroxypropyl)-4-fluorobenzaldehyde.
| Compound Name | 2-(3-amino-1,2-dihydroxypropyl)-4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 170827927 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-(3-amino-1,2-dihydroxypropyl)-4-fluorobenzaldehyde |
| SMILES | NCC(O)C(O)c1cc(F)ccc1C=O |
| InChI | InChI=1S/C10H12FNO3/c11-7-2-1-6(5-13)8(3-7)10(15)9(14)4-12/h1-3,5,9-10,14-15H,4,12H2 |
| InChIKey | OOGWVNDHWGRUEZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|