C11H12ClFO3 — CID 171893688
2-(4-chloro-1,2-dihydroxybutyl)-5-fluorobenzaldehyde (PubChem CID 171893688) has the molecular formula C11H12ClFO3 and a molecular weight of 246.66 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroxybutyl)-5-fluorobenzaldehyde.
| Compound Name | 2-(4-chloro-1,2-dihydroxybutyl)-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 171893688 |
| Molecular Formula | C11H12ClFO3 |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroxybutyl)-5-fluorobenzaldehyde |
| SMILES | O=Cc1cc(F)ccc1C(O)C(O)CCCl |
| InChI | InChI=1S/C11H12ClFO3/c12-4-3-10(15)11(16)9-2-1-8(13)5-7(9)6-14/h1-2,5-6,10-11,15-16H,3-4H2 |
| InChIKey | YGXUELHOLYAWMR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|