C11H11ClF2O3 — CID 171894152
3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzaldehyde (PubChem CID 171894152) has the molecular formula C11H11ClF2O3 and a molecular weight of 264.65 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzaldehyde.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzaldehyde |
|---|---|
| PubChem CID | 171894152 |
| Molecular Formula | C11H11ClF2O3 |
| Molecular Weight | 264.65 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)-2,6-difluorobenzaldehyde |
| SMILES | O=Cc1c(F)ccc(C(O)C(O)CCCl)c1F |
| InChI | InChI=1S/C11H11ClF2O3/c12-4-3-9(16)11(17)6-1-2-8(13)7(5-15)10(6)14/h1-2,5,9,11,16-17H,3-4H2 |
| InChIKey | KRYDHLVAXDPQSX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.65 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|