C10H12Cl2FNO2 — CID 171893871
1-(2-amino-5-chloro-3-fluorophenyl)-4-chlorobutane-1,2-diol (PubChem CID 171893871) has the molecular formula C10H12Cl2FNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-fluorophenyl)-4-chlorobutane-1,2-diol.
| Compound Name | 1-(2-amino-5-chloro-3-fluorophenyl)-4-chlorobutane-1,2-diol |
|---|---|
| PubChem CID | 171893871 |
| Molecular Formula | C10H12Cl2FNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1-(2-amino-5-chloro-3-fluorophenyl)-4-chlorobutane-1,2-diol |
| SMILES | Nc1c(F)cc(Cl)cc1C(O)C(O)CCCl |
| InChI | InChI=1S/C10H12Cl2FNO2/c11-2-1-8(15)10(16)6-3-5(12)4-7(13)9(6)14/h3-4,8,10,15-16H,1-2,14H2 |
| InChIKey | FZWHUHBPLWGHJO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|