C9H12ClFN2O2 — CID 170828108
3-amino-1-(2-amino-5-chloro-3-fluorophenyl)propane-1,2-diol (PubChem CID 170828108) has the molecular formula C9H12ClFN2O2 and a molecular weight of 234.66 g/mol. Its IUPAC name is 3-amino-1-(2-amino-5-chloro-3-fluorophenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2-amino-5-chloro-3-fluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828108 |
| Molecular Formula | C9H12ClFN2O2 |
| Molecular Weight | 234.66 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-amino-1-(2-amino-5-chloro-3-fluorophenyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cc(Cl)cc(F)c1N |
| InChI | InChI=1S/C9H12ClFN2O2/c10-4-1-5(8(13)6(11)2-4)9(15)7(14)3-12/h1-2,7,9,14-15H,3,12-13H2 |
| InChIKey | VQFXOXFABKYZBD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.66 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|