C8H10ClFN2O2 — CID 170829115
3-amino-1-(5-chloro-2-fluoro-4-pyridinyl)propane-1,2-diol (PubChem CID 170829115) has the molecular formula C8H10ClFN2O2 and a molecular weight of 220.63 g/mol. Its IUPAC name is 3-amino-1-(5-chloro-2-fluoro-4-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(5-chloro-2-fluoro-4-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170829115 |
| Molecular Formula | C8H10ClFN2O2 |
| Molecular Weight | 220.63 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 3-amino-1-(5-chloro-2-fluoro-4-pyridinyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cc(F)ncc1Cl |
| InChI | InChI=1S/C8H10ClFN2O2/c9-5-3-12-7(10)1-4(5)8(14)6(13)2-11/h1,3,6,8,13-14H,2,11H2 |
| InChIKey | HFKNWLPRVAHLQN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.63 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|