C10H12ClNO4 — CID 170828286
3-(3-amino-1,2-dihydroxypropyl)-4-chlorobenzoic acid (PubChem CID 170828286) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxypropyl)-4-chlorobenzoic acid.
| Compound Name | 3-(3-amino-1,2-dihydroxypropyl)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 170828286 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-(3-amino-1,2-dihydroxypropyl)-4-chlorobenzoic acid |
| SMILES | NCC(O)C(O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H12ClNO4/c11-7-2-1-5(10(15)16)3-6(7)9(14)8(13)4-12/h1-3,8-9,13-14H,4,12H2,(H,15,16) |
| InChIKey | KLKMIKUIZMKFBJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |