C10H10ClNO5 — CID 171868426
3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-chlorobenzoic acid (PubChem CID 171868426) has the molecular formula C10H10ClNO5 and a molecular weight of 259.64 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-chlorobenzoic acid.
| Compound Name | 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 171868426 |
| Molecular Formula | C10H10ClNO5 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-chlorobenzoic acid |
| SMILES | NC(=O)C(O)C(O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H10ClNO5/c11-6-2-1-4(10(16)17)3-5(6)7(13)8(14)9(12)15/h1-3,7-8,13-14H,(H2,12,15)(H,16,17) |
| InChIKey | BGCVGFBCUNVEEX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |