C9H10Cl2N2O3 — CID 171868242
3-(4-amino-2,3-dichlorophenyl)-2,3-dihydroxypropanamide (PubChem CID 171868242) has the molecular formula C9H10Cl2N2O3 and a molecular weight of 265.10 g/mol. Its IUPAC name is 3-(4-amino-2,3-dichlorophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(4-amino-2,3-dichlorophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868242 |
| Molecular Formula | C9H10Cl2N2O3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 3-(4-amino-2,3-dichlorophenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(N)c(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O3/c10-5-3(1-2-4(12)6(5)11)7(14)8(15)9(13)16/h1-2,7-8,14-15H,12H2,(H2,13,16) |
| InChIKey | SXIOTAZTHDBQOR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|