C10H9F2NO4 — CID 171868515
3-(2,4-difluoro-3-formylphenyl)-2,3-dihydroxypropanamide (PubChem CID 171868515) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is 3-(2,4-difluoro-3-formylphenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2,4-difluoro-3-formylphenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868515 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-(2,4-difluoro-3-formylphenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(F)c(C=O)c1F |
| InChI | InChI=1S/C10H9F2NO4/c11-6-2-1-4(7(12)5(6)3-14)8(15)9(16)10(13)17/h1-3,8-9,15-16H,(H2,13,17) |
| InChIKey | NHTRNZPDDPDHQF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|