C9H8Cl2FNO3 — CID 171867980
3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropanamide (PubChem CID 171867980) has the molecular formula C9H8Cl2FNO3 and a molecular weight of 268.07 g/mol. Its IUPAC name is 3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867980 |
| Molecular Formula | C9H8Cl2FNO3 |
| Molecular Weight | 268.07 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 3-(2,5-dichloro-3-fluorophenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cc(Cl)cc(F)c1Cl |
| InChI | InChI=1S/C9H8Cl2FNO3/c10-3-1-4(6(11)5(12)2-3)7(14)8(15)9(13)16/h1-2,7-8,14-15H,(H2,13,16) |
| InChIKey | FSTIOYCAUHZLIV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.07 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|