C8H8ClFN2O3 — CID 171867911
3-(6-chloro-5-fluoro-3-pyridinyl)-2,3-dihydroxypropanamide (PubChem CID 171867911) has the molecular formula C8H8ClFN2O3 and a molecular weight of 234.61 g/mol. Its IUPAC name is 3-(6-chloro-5-fluoro-3-pyridinyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(6-chloro-5-fluoro-3-pyridinyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867911 |
| Molecular Formula | C8H8ClFN2O3 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 3-(6-chloro-5-fluoro-3-pyridinyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C8H8ClFN2O3/c9-7-4(10)1-3(2-12-7)5(13)6(14)8(11)15/h1-2,5-6,13-14H,(H2,11,15) |
| InChIKey | ZSDIRDXQQYGHBD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|