C11H11ClF3NO4 — CID 171866757
ethyl 3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate (PubChem CID 171866757) has the molecular formula C11H11ClF3NO4 and a molecular weight of 313.66 g/mol. Its IUPAC name is ethyl 3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866757 |
| Molecular Formula | C11H11ClF3NO4 |
| Molecular Weight | 313.66 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | ethyl 3-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11ClF3NO4/c1-2-20-10(19)8(18)7(17)5-3-6(11(13,14)15)9(12)16-4-5/h3-4,7-8,17-18H,2H2,1H3 |
| InChIKey | SFUMLBFFJUDVTK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|