C10H13ClN2O4 — CID 171865754
ethyl 3-(3-amino-5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate (PubChem CID 171865754) has the molecular formula C10H13ClN2O4 and a molecular weight of 260.68 g/mol. Its IUPAC name is ethyl 3-(3-amino-5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-amino-5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865754 |
| Molecular Formula | C10H13ClN2O4 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | ethyl 3-(3-amino-5-chloro-2-pyridinyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ncc(Cl)cc1N |
| InChI | InChI=1S/C10H13ClN2O4/c1-2-17-10(16)9(15)8(14)7-6(12)3-5(11)4-13-7/h3-4,8-9,14-15H,2,12H2,1H3 |
| InChIKey | IJXJHMGDKADQCN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |