C9H11ClN2O4 — CID 118141576
ethyl 3-(2-chloropyrimidin-5-yl)-2,3-dihydroxypropanoate (PubChem CID 118141576) has the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. Its IUPAC name is ethyl 3-(2-chloropyrimidin-5-yl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2-chloropyrimidin-5-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 118141576 |
| Molecular Formula | C9H11ClN2O4 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | ethyl 3-(2-chloropyrimidin-5-yl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C9H11ClN2O4/c1-2-16-8(15)7(14)6(13)5-3-11-9(10)12-4-5/h3-4,6-7,13-14H,2H2,1H3 |
| InChIKey | QGJBBWWCBHDYKY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |