C12H14N4O4 — CID 171866849
ethyl 2,3-dihydroxy-3-(2-imidazol-1-ylpyrimidin-5-yl)propanoate (PubChem CID 171866849) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(2-imidazol-1-ylpyrimidin-5-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(2-imidazol-1-ylpyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 171866849 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(2-imidazol-1-ylpyrimidin-5-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C12H14N4O4/c1-2-20-11(19)10(18)9(17)8-5-14-12(15-6-8)16-4-3-13-7-16/h3-7,9-10,17-18H,2H2,1H3 |
| InChIKey | XKQKBNMNISWFPL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |