C9H14N2O4 — CID 171867145
ethyl 2,3-dihydroxy-3-(1-methylimidazol-4-yl)propanoate (PubChem CID 171867145) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(1-methylimidazol-4-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(1-methylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 171867145 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(1-methylimidazol-4-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cn(C)cn1 |
| InChI | InChI=1S/C9H14N2O4/c1-3-15-9(14)8(13)7(12)6-4-11(2)5-10-6/h4-5,7-8,12-13H,3H2,1-2H3 |
| InChIKey | TXSMOWZAOIHMBV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |